Labguru · Schema

Labguru API Schemas

JSON Schema definitions for the Labguru REST API

Electronic Lab NotebookELNLIMSLaboratory Information ManagementBiotechLife SciencesResearch Data ManagementInventory ManagementExperiment ManagementREST APIGraphQL
View JSON Schema on GitHub

JSON Schema

labguru-schemas.json Raw ↑
{
  "$schema": "http://json-schema.org/draft-07/schema#",
  "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/labguru-schemas.json",
  "title": "Labguru API Schemas",
  "description": "JSON Schema definitions for the Labguru REST API",
  "definitions": {
    "createSession": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createSession.json",
      "title": "createSession",
      "type": "object",
      "required": [
        "login",
        "password"
      ],
      "properties": {
        "login": {
          "type": "string",
          "description": "E-mail",
          "example": "labuser@email.com"
        },
        "password": {
          "type": "string",
          "description": "password"
        },
        "account_id": {
          "type": "integer",
          "description": "(optional) The account id to generate the token for"
        }
      }
    },
    "createAttachment": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createAttachment.json",
      "title": "createAttachment",
      "type": "object",
      "properties": {
        "token": {
          "type": "string"
        },
        "item[attachment]": {
          "type": "string",
          "format": "binary",
          "description": "The file that will be uploaded."
        },
        "item[title]": {
          "type": "string",
          "example": "Project_report.pdf",
          "description": "The title of the attachment. <b>This should match the file name exactly, including the file extension (.xlsx, .csv, etc.)</b>."
        },
        "item[attach_to_uuid]": {
          "type": "string",
          "description": "The UUID of the object to which the attachment will be linked.<br>\n                If this parameter is not provided, the uploaded file will be stored but not associated with any specific entity (unattached file)."
        },
        "item[description]": {
          "type": "string",
          "example": "Detailed project report",
          "description": "A brief description of the attachment content."
        }
      },
      "required": [
        "token",
        "item[attachment]",
        "item[title]"
      ]
    },
    "updateAttachment": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateAttachment.json",
      "title": "updateAttachment",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "required": [
            "element_id"
          ],
          "properties": {
            "element_id": {
              "type": "integer",
              "description": "The ID of the attachment element to which the attachment will be linked"
            }
          }
        }
      }
    },
    "WormBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/WormBaseRequest.json",
      "title": "WormBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "name": {
              "type": "string",
              "description": "The name of the worm"
            },
            "alternative_name": {
              "type": "string",
              "description": "An alternative name for the worm"
            },
            "gene_id": {
              "type": "integer",
              "description": "An ID reference to a gene from your labguru genes collection"
            },
            "source": {
              "type": "string",
              "description": "Origin of the worm"
            },
            "genotype": {
              "type": "string",
              "description": "Genetic constitution of the worm"
            },
            "phenotype": {
              "type": "string",
              "description": "Observable physical or biochemical characteristics of the worm"
            },
            "mutagen": {
              "type": "string",
              "description": "The agent used to induce mutations in the worm"
            },
            "growth_conditions": {
              "type": "string",
              "description": "Specific conditions under which the worm is maintained"
            },
            "outcrossed": {
              "type": "integer",
              "description": "Number of times the worm strain has been outcrossed with another"
            },
            "made_by": {
              "type": "string",
              "description": "researcher name input"
            },
            "dauer_defective": {
              "type": "boolean",
              "description": "Indicates whether the worm is defective in entering or exiting the dauer stage,\n                    with '1' for yes and '0' for no.",
              "example": 0
            },
            "description": {
              "type": "string",
              "description": "Description of the worm"
            }
          }
        }
      }
    },
    "createWorm": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createWorm.json",
      "title": "createWorm",
      "allOf": [
        {
          "$ref": "#/components/schemas/WormBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "name"
              ]
            }
          }
        }
      ]
    },
    "updateWorm": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateWorm.json",
      "title": "updateWorm",
      "allOf": [
        {
          "$ref": "#/components/schemas/WormBaseRequest"
        }
      ]
    },
    "AntibodyBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/AntibodyBaseRequest.json",
      "title": "AntibodyBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "title": {
              "type": "string",
              "description": "The name of the antibody"
            },
            "owner_id": {
              "type": "integer",
              "description": "The ID of the owner - by default it's your member id"
            },
            "alternative_name": {
              "type": "string",
              "description": "An additional name for the antibody"
            },
            "antigene": {
              "type": "string",
              "description": "Antigen / immunogen"
            },
            "tags_fluorophores": {
              "type": "string",
              "description": "Tags / fluorophores"
            },
            "clone_field": {
              "type": "string",
              "description": "The clone from which the antibody was derived."
            },
            "isotype": {
              "type": "string",
              "description": "The class or type of the antibody (e.g., IgG, IgM)."
            },
            "preparation_date": {
              "type": "string",
              "format": "date",
              "description": "The date on which the antibody was prepared, formatted as YYYY-MM-DD.",
              "example": "yyyy-mm-dd"
            },
            "source": {
              "type": "string",
              "description": "The origin or source from which the antibody was obtained."
            },
            "immune": {
              "type": "integer",
              "description": "Indicates the antibody's clonality: \"Monoclonal\" (immune = 1), \"Polyclonal\" (immune = 0), or \"None\" (Empty value).",
              "example": 1
            },
            "organism_id": {
              "type": "integer",
              "description": "The ID for the organism in which the antibody was raised. This ID corresponds to specific organisms (e.g., 5 for Mouse, 6 for Chicken, etc.)."
            },
            "reacts_with": {
              "type": "string",
              "description": "Specifies the organism or group the antibody is reactive with, chosen from a predefined list of options such as \"Mouse\", \"Human\", \"Chicken\", and \"Zebrafish\", etc.",
              "example": "Mouse"
            },
            "description": {
              "type": "string",
              "description": "A detailed description of the antibody"
            }
          }
        }
      }
    },
    "createAntibody": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createAntibody.json",
      "title": "createAntibody",
      "allOf": [
        {
          "$ref": "#/components/schemas/AntibodyBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "title"
              ]
            }
          }
        }
      ]
    },
    "updateAntibody": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateAntibody.json",
      "title": "updateAntibody",
      "allOf": [
        {
          "$ref": "#/components/schemas/AntibodyBaseRequest"
        }
      ]
    },
    "ExperimentBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/ExperimentBaseRequest.json",
      "title": "ExperimentBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "title": {
              "type": "string",
              "description": "The experiment title"
            },
            "project_id": {
              "type": "integer",
              "description": "The project id"
            },
            "milestone_id": {
              "type": "integer",
              "description": "You can also provide a milestone_name(string) instead of milestone_id(integer)"
            },
            "protocol_id": {
              "type": "integer",
              "description": "Start experiment from protocol by providing the protocol id "
            }
          }
        }
      }
    },
    "addExperiment": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/addExperiment.json",
      "title": "addExperiment",
      "allOf": [
        {
          "$ref": "#/components/schemas/ExperimentBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "title",
                "project_id",
                "milestone_id"
              ]
            }
          }
        }
      ]
    },
    "updateExperiment": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateExperiment.json",
      "title": "updateExperiment",
      "allOf": [
        {
          "$ref": "#/components/schemas/ExperimentBaseRequest"
        }
      ]
    },
    "PlasmidBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/PlasmidBaseRequest.json",
      "title": "PlasmidBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "title": {
              "type": "string",
              "description": "The name of the plasmid"
            },
            "alternative_name": {
              "type": "string",
              "description": "Any alternative name by which the plasmid may be known"
            },
            "owner_id": {
              "type": "integer",
              "description": "id of the owner - by default it's your member id"
            },
            "length": {
              "type": "integer",
              "description": "The total number of base pairs (bp) in the plasmid\u2019s DNA sequence."
            },
            "usage": {
              "type": "string",
              "description": "Intended or common uses of the plasmid (cloning, gene expression, etc.)"
            },
            "host": {
              "type": "string",
              "description": "Typical host organism for the plasmid"
            },
            "resistance": {
              "type": "string",
              "description": "Antibiotic resistance markers present in the plasmid"
            },
            "clone_number": {
              "type": "string",
              "description": "Unique identifier or clone number associated with the plasmid"
            },
            "source": {
              "type": "string",
              "description": "Origin or provider of the plasmid"
            },
            "sequence": {
              "type": "string",
              "description": "The nucleotide sequence of the plasmid"
            },
            "description": {
              "type": "string",
              "description": "A detailed description of the plasmid"
            }
          }
        }
      }
    },
    "createPlasmid": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createPlasmid.json",
      "title": "createPlasmid",
      "allOf": [
        {
          "$ref": "#/components/schemas/PlasmidBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "title"
              ]
            }
          }
        }
      ]
    },
    "updatePlasmid": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updatePlasmid.json",
      "title": "updatePlasmid",
      "allOf": [
        {
          "$ref": "#/components/schemas/PlasmidBaseRequest"
        }
      ]
    },
    "SOPBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/SOPBaseRequest.json",
      "title": "SOPBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "title": {
              "type": "string",
              "description": "The name of the SOP"
            }
          }
        }
      }
    },
    "createSOP": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createSOP.json",
      "title": "createSOP",
      "allOf": [
        {
          "$ref": "#/components/schemas/SOPBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "title"
              ]
            }
          }
        }
      ]
    },
    "updateSOP": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateSOP.json",
      "title": "updateSOP",
      "allOf": [
        {
          "$ref": "#/components/schemas/SOPBaseRequest"
        }
      ]
    },
    "createComment": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createComment.json",
      "title": "createComment",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "required": [
            "comment",
            "commentable_id",
            "commentable_type"
          ],
          "properties": {
            "comment": {
              "type": "string",
              "description": "The text content of the comment"
            },
            "commentable_id": {
              "type": "integer",
              "description": "The id of the item to which the comment is being added"
            },
            "commentable_type": {
              "type": "string",
              "description": "Specifies the class name of the item to which the comment is attached, such as Biocollections::Plasmid"
            }
          }
        }
      }
    },
    "LinkBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/LinkBaseRequest.json",
      "title": "LinkBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "source_id": {
              "type": "integer",
              "description": "The ID of the source item"
            },
            "source_type": {
              "type": "string",
              "description": "Specifies the class name of the source item, such as Biocollections::Plasmid"
            },
            "target_id": {
              "type": "integer",
              "description": "The ID of the target item"
            },
            "target_type": {
              "type": "string",
              "description": "Specifies the class name of the target item, such as Biocollections::Antibody"
            },
            "source_uuid": {
              "type": "string",
              "description": "The UUID of the source item"
            },
            "target_uuid": {
              "type": "string",
              "description": "The UUID of the target item"
            }
          }
        }
      }
    },
    "createLink": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createLink.json",
      "title": "createLink",
      "allOf": [
        {
          "$ref": "#/components/schemas/LinkBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "source_id",
                "source_type",
                "target_id",
                "target_type",
                "source_uuid",
                "target_uuid"
              ]
            }
          }
        }
      ]
    },
    "updateLink": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateLink.json",
      "title": "updateLink",
      "allOf": [
        {
          "$ref": "#/components/schemas/LinkBaseRequest"
        }
      ]
    },
    "CompoundBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/CompoundBaseRequest.json",
      "title": "CompoundBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "smiles": {
          "type": "string",
          "example": "C(=O)N1CCC(CCCC(=O)c2ccc(Cl)n(Cc3ncc(o3)-c3ccc(Cl)cc3)c2=O)CC1"
        },
        "item": {
          "type": "object",
          "properties": {
            "name": {
              "type": "string",
              "description": "The name of the compound"
            },
            "description": {
              "type": "string",
              "description": "Updated description of the compound"
            },
            "structure": {
              "type": "string",
              "description": "Compound structure",
              "example": "C(=O)N1CCC(CCCC(=O)c2ccc(Cl)n(Cc3ncc(o3)-c3ccc(Cl)cc3)c2=O)CC1"
            },
            "cas": {
              "type": "string",
              "description": "Compound CAS"
            },
            "formula": {
              "type": "string",
              "description": "Compound formula"
            },
            "molar_mass": {
              "type": "string",
              "description": "Compound molar mass"
            },
            "density": {
              "type": "string",
              "description": "Compound density"
            },
            "boiling_point": {
              "type": "string",
              "description": "Compound boiling point"
            },
            "melting_point": {
              "type": "string",
              "description": "Compound melting point"
            },
            "hazards": {
              "type": "string",
              "description": "Compound hazards"
            }
          }
        }
      }
    },
    "createCompound": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createCompound.json",
      "title": "createCompound",
      "allOf": [
        {
          "$ref": "#/components/schemas/CompoundBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "name"
              ]
            }
          }
        }
      ]
    },
    "updateCompound": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateCompound.json",
      "title": "updateCompound",
      "allOf": [
        {
          "$ref": "#/components/schemas/CompoundBaseRequest"
        }
      ]
    },
    "TaskBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/TaskBaseRequest.json",
      "title": "TaskBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "required": [
            "name"
          ],
          "properties": {
            "name": {
              "type": "string",
              "description": "The name of the Task"
            },
            "start_date": {
              "type": "string",
              "format": "date",
              "description": "Start Date (yyyy-mm-dd)"
            },
            "assigned_to": {
              "type": "integer",
              "description": "id of assigner"
            },
            "description": {
              "type": "string",
              "description": "Description of the task"
            },
            "owner_id": {
              "type": "integer",
              "description": "id of the owner - by default it's your member id"
            },
            "notify_at": {
              "type": "string",
              "format": "date",
              "description": "notification date & time (yyyy-mm-dd)"
            }
          }
        }
      }
    },
    "createTask": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createTask.json",
      "title": "createTask",
      "allOf": [
        {
          "$ref": "#/components/schemas/TaskBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "name"
              ]
            }
          }
        }
      ]
    },
    "updateTask": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateTask.json",
      "title": "updateTask",
      "allOf": [
        {
          "$ref": "#/components/schemas/TaskBaseRequest"
        }
      ]
    },
    "RodentCageBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/RodentCageBaseRequest.json",
      "title": "RodentCageBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "name": {
              "type": "string",
              "description": "The name of the Rodent cage"
            },
            "breeding": {
              "type": "boolean",
              "description": "Breeding - by default it's true"
            },
            "parent_id": {
              "type": "integer",
              "description": "The ID of the storage location"
            },
            "description": {
              "type": "string",
              "description": "Detailed cage information"
            },
            "owner_id": {
              "type": "integer",
              "description": "id of the owner - by default it's your member id"
            }
          }
        }
      }
    },
    "createRodentCage": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createRodentCage.json",
      "title": "createRodentCage",
      "allOf": [
        {
          "$ref": "#/components/schemas/RodentCageBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "name"
              ]
            }
          }
        }
      ]
    },
    "updateRodentCage": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateRodentCage.json",
      "title": "updateRodentCage",
      "allOf": [
        {
          "$ref": "#/components/schemas/RodentCageBaseRequest"
        }
      ]
    },
    "GeneBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/GeneBaseRequest.json",
      "title": "GeneBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "title": {
              "type": "string",
              "description": "The name of the gene"
            },
            "alternative_name": {
              "type": "string",
              "description": "Alternative gene name."
            },
            "expression_location": {
              "type": "string",
              "description": "Location of gene expression."
            },
            "pathway": {
              "type": "string",
              "description": "Involved metabolic pathway."
            },
            "sequence": {
              "type": "string",
              "description": "Gene sequence.",
              "example": "ACTGACGACATGGTTCTGACCTGA"
            },
            "owner_id": {
              "type": "integer",
              "description": "id of the owner - by default it's your member id"
            },
            "source": {
              "type": "string",
              "description": "The origin or source from which the gene was obtained."
            },
            "description": {
              "type": "string",
              "description": "Detailed gene information."
            }
          }
        }
      }
    },
    "createGene": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/createGene.json",
      "title": "createGene",
      "allOf": [
        {
          "$ref": "#/components/schemas/GeneBaseRequest"
        },
        {
          "type": "object",
          "properties": {
            "item": {
              "type": "object",
              "required": [
                "title"
              ]
            }
          }
        }
      ]
    },
    "updateGene": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/updateGene.json",
      "title": "updateGene",
      "allOf": [
        {
          "$ref": "#/components/schemas/GeneBaseRequest"
        }
      ]
    },
    "VirusBaseRequest": {
      "$schema": "http://json-schema.org/draft-07/schema#",
      "$id": "https://raw.githubusercontent.com/api-evangelist/labguru/main/json-schema/VirusBaseRequest.json",
      "title": "VirusBaseRequest",
      "type": "object",
      "required": [
        "token"
      ],
      "properties": {
        "token": {
          "type": "string",
          "example": "YOUR TOKEN IS HERE"
        },
        "item": {
          "type": "object",
          "properties": {
            "name": {
              "type": "string",
              "description": "The name of the virus"
            },
            "alternative_name": {
              "type": "string",
              "description": "alternative name for the virus"
            },
            "gene_insert": {
              "type": "string",
              "description": "Specific gene or genetic insert present in the virus"
            },
            "virus_type": {
              "type": "string",
              "description": "The virus type"
            },
            "plasmid": {
              "type": "string",
              "description": "The plasmid that is used in the creation or manipulation of the virus"
            },
            "serotype_strain": {
              "type": "string",
              "description": "serotype or strain of the virus"
            },
            "mutations_deletions": {
              "type": "string",
              "description": "genetic mutations or deletions within the virus details"
            },
            "tag": {
              "type": "string",
              "description": "Tag"
            },
            "selectable_marker": {
              "type": "string",
              "description": "Selectable marker"
            },
            "producer_cell_type": {
              "type": "string",
              "description": "Producer cell type"
            },
            "viral_coat": {
              "type": "string",
              "description": "Viral coat"
            },
            "tropism": {
              "type": "string",
              "description": "Tropism"
            },
            "species": {
              "type": "string",
              "

# --- truncated at 32 KB (174 KB total) ---
# Full source: https://raw.githubusercontent.com/api-evangelist/labguru/refs/heads/main/json-schema/labguru-schemas.json

Work with this as data

Every JSON Schema here is available over the APIs.io API and to AI agents over MCP.

MCP server

One button, every client — Claude, Cursor, VS Code and the rest.

https://apis.io/mcp

Tools for schemas

4 MCP tools reach this
  • find_json_schemasBrowse and filter every JSON Schema in the catalog.
  • apis_io_searchSTART HERE — APIs, providers and tags for one query, each with its total.
  • resolveTurn a domain, URL or GitHub org into the provider it belongs to.
  • find_cohortsEvery scored population of providers in the catalog.
All 92 tools →

Call it yourself

curl for this page
This JSON Schema
curl "https://apis.io/api/v1/json-schemas/labguru-schemas"
All schemas
curl "https://apis.io/api/v1/json-schemas?limit=25"

Discovery needs no key. Ratings and market analysis are Pro.

Get an API key

Free tier, no form to fill in. Signing in shares your email address with us — we store it to create your key and to recognise you if you sign in with another provider. See our Privacy Policy and Terms.

A second provider on the same verified email joins the account you already have.