openFDA · Example Payload
Substance Data
FDAFood and Drug AdministrationDrug SafetyAdverse EventsDrug LabelsRecallsMedical DevicesFood SafetyTobaccoPublic HealthOpen DataGovernmentRegulatoryFAERSSPL
Substance Data is an example object payload from openFDA, with 2 top-level fields. It illustrates the shape of data this provider's APIs accept or return.
Top-level fields
metaresults
Example Payload
{
"meta": {
"disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
"terms": "https://open.fda.gov/terms/",
"license": "https://open.fda.gov/license/",
"last_updated": "2025-09-19",
"results": {
"skip": 0,
"limit": 1,
"total": 167385
}
},
"results": [
{
"codes": [
{
"uuid": "ec8f901c-2d5c-478a-94b8-872dae8ae038",
"code": "288254-16-0",
"type": "PRIMARY",
"url": "https://commonchemistry.cas.org/detail?cas_rn=288254-16-0",
"code_system": "CAS",
"references": [
"e65b4d0b-ef98-4869-b268-d1bd416d029a",
"69642f3b-863f-40c5-94e6-e12e37af47b8"
]
},
{
"uuid": "61663075-e0a8-47e8-9f3d-958ba8504270",
"code": "10123230",
"type": "PRIMARY",
"url": "https://pubchem.ncbi.nlm.nih.gov/compound/10123230",
"code_system": "PUBCHEM",
"references": [
"e65b4d0b-ef98-4869-b268-d1bd416d029a"
]
},
{
"uuid": "6455d545-10f2-4b2a-abae-1d9774e86e56",
"code": "BU9H717REF",
"type": "PRIMARY",
"code_system": "FDA UNII"
},
{
"uuid": "d9c439dc-1938-52a9-0db2-e0b68166edfe",
"code": "DTXSID501021214",
"type": "PRIMARY",
"url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501021214",
"code_system": "EPA CompTox"
}
],
"substance_class": "chemical",
"names": [
{
"uuid": "c84ffec4-b6bd-4a98-899b-551982c757b8",
"name": "(±)-ETHYLHEXYL BIS-ISOPENTYLBENZOXAZOLYLPHENYL MELAMINE",
"stdName": "(+/-)-ETHYLHEXYL BIS-ISOPENTYLBENZOXAZOLYLPHENYL MELAMINE",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"9d0d79ce-8d0a-47f1-8dc8-88d2c7b14b6c",
"615b0b2d-99d2-46e5-a565-bdc94e57ad5b"
],
"display_name": false
},
{
"uuid": "623b728b-5903-4a95-b8a0-d25555dc811e",
"name": "1,3,5-TRIAZINE-2,4,6-TRIAMINE, N,N'-BIS(4-(5-(1,1-DIMETHYLPROPYL)-2-BENZOXAZOLYL)PHENYL)-N''-(2-ETHYLHEXYL)-",
"stdName": "1,3,5-TRIAZINE-2,4,6-TRIAMINE, N,N'-BIS(4-(5-(1,1-DIMETHYLPROPYL)-2-BENZOXAZOLYL)PHENYL)-N''-(2-ETHYLHEXYL)-",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"bd0386ed-e239-4157-aa1c-390548065d59",
"9d0d79ce-8d0a-47f1-8dc8-88d2c7b14b6c"
],
"display_name": false
},
{
"uuid": "f922da55-91af-4c23-bd4b-3f82d88b24ad",
"name": "1,3,5-TRIAZINE-2,4,6-TRIAMINE, N2,N4-BIS(4-(5-(1,1-DIMETHYLPROPYL)-2-BENZOXAZOLYL)PHENYL)-N6-(2-ETHYLHEXYL)-",
"stdName": "1,3,5-TRIAZINE-2,4,6-TRIAMINE, N2,N4-BIS(4-(5-(1,1-DIMETHYLPROPYL)-2-BENZOXAZOLYL)PHENYL)-N6-(2-ETHYLHEXYL)-",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"bd0386ed-e239-4157-aa1c-390548065d59",
"9d0d79ce-8d0a-47f1-8dc8-88d2c7b14b6c"
],
"display_name": false
},
{
"uuid": "5de8f5f0-7b33-4252-b5dd-8d2bc0bcb9d4",
"name": "2,4-BIS(5-(1-DIMETHYLPROPYL)BENZOXAZOL-2-YL(4-PHENYL)IMINO)-6-(2-ETHYLHEXYL)IMINO-1,3,5-TRIAZINE",
"stdName": "2,4-BIS(5-(1-DIMETHYLPROPYL)BENZOXAZOL-2-YL(4-PHENYL)IMINO)-6-(2-ETHYLHEXYL)IMINO-1,3,5-TRIAZINE",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"bd0386ed-e239-4157-aa1c-390548065d59",
"9d0d79ce-8d0a-47f1-8dc8-88d2c7b14b6c"
],
"display_name": false
},
{
"uuid": "9dfcaf8f-3584-4431-8b6a-08032c75c18a",
"name": "ETHYLHEXYL BIS-ISOPENTYLBENZOXAZOLYLPHENYL MELAMINE",
"stdName": "ETHYLHEXYL BIS-ISOPENTYLBENZOXAZOLYLPHENYL MELAMINE",
"type": "of",
"languages": [
"en"
],
"preferred": false,
"references": [
"3eb92df7-9626-4d02-a10f-1c26f8a0ef80",
"9d0d79ce-8d0a-47f1-8dc8-88d2c7b14b6c",
"97a61e52-ed32-4652-9824-0747e0054582"
],
"display_name": true,
"domains": [
"cosmetic"
],
"name_orgs": [
{
"uuid": "44727604-e81b-4fd1-8d3e-06dfdef5d46f",
"name_org": "INCI"
}
]
},
{
"uuid": "65852eb2-599d-44d7-a0a7-468f6eace6f1",
"name": "ETHYLHEXYL BIS-ISOPENTYLBENZOXAZOLYLPHENYL MELAMINE, (±)-",
"stdName": "ETHYLHEXYL BIS-ISOPENTYLBENZOXAZOLYLPHENYL MELAMINE, (+/-)-",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"9d0d79ce-8d0a-47f1-8dc8-88d2c7b14b6c",
"615b0b2d-99d2-46e5-a565-bdc94e57ad5b"
],
"display_name": false
},
{
"uuid": "ac01fc89-d4b8-45b9-8de0-59736ad798aa",
"name": "UVASORB K2A",
"stdName": "UVASORB K2A",
"type": "bn",
"languages": [
"en"
],
"preferred": false,
"references": [
"3eb92df7-9626-4d02-a10f-1c26f8a0ef80",
"9d0d79ce-8d0a-47f1-8dc8-88d2c7b14b6c"
],
"display_name": false
}
],
"references": [
{
"uuid": "3eb92df7-9626-4d02-a10f-1c26f8a0ef80",
"citation": "PCPC-DB",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN",
"PUBLIC_DOMAIN_RELEASE",
"AUTO_SELECTED"
]
},
{
"uuid": "9d0d79ce-8d0a-47f1-8dc8-88d2c7b14b6c",
"citation": "PERSONAL CARE PRODUCTS COUNCIL",
"doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "bd0386ed-e239-4157-aa1c-390548065d59",
"citation": "STN",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "615b0b2d-99d2-46e5-a565-bdc94e57ad5b",
"citation": "FDA_SRS",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "e65b4d0b-ef98-4869-b268-d1bd416d029a",
"citation": "SRS CODE IMPORT",
"doc_type": "SRS",
"public_domain": true,
"document_date": 1493391502000,
"tags": [
"NOMEN"
]
},
{
"uuid": "1a68b8de-ec2d-4858-a55b-b06a4a40d927",
"citation": "SRS import [BU9H717REF]",
"url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BU9H717REF",
"doc_type": "SRS",
"public_domain": true,
"document_date": 1493391502000,
"tags": [
"NOMEN"
]
},
{
"uuid": "97a61e52-ed32-4652-9824-0747e0054582",
"citation": "ETHYLHEXYL BIS-ISOPENTYLBENZOXAZOLYLPHENYL MELAMINE [INCI]",
"doc_type": "SRS_LOCATOR",
"public_domain": true
},
{
"uuid": "69642f3b-863f-40c5-94e6-e12e37af47b8",
"citation": "STN",
"doc_type": "STN (SCIFINDER)",
"public_domain": true
}
],
"definition_type": "PRIMARY",
"moieties": [
{
"uuid": "0408b324-b625-49c6-ae9a-3cbfd5fd716f",
"id": "0408b324-b625-49c6-ae9a-3cbfd5fd716f",
"molfile": "\n Marvin 01132100312D \n\n 57 63 0 0 0 0 999 V2000\n 5.5360 -0.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5360 -1.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9593 -1.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9593 -2.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3825 -2.5942 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.8057 -2.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8057 -1.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3825 -3.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9593 -3.5932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9593 -4.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3531 -4.5352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2893 -5.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6816 -5.4777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6816 -6.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9694 -6.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9687 -7.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6807 -7.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3957 -7.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3910 -6.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6807 -8.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0073 -9.2320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2478 -10.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8260 -10.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2325 -11.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0651 -11.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4831 -10.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0771 -10.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3418 -9.2563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8180 -12.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2325 -12.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9889 -12.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4034 -12.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8180 -13.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8358 -5.5895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4415 -5.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5273 -5.6949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5273 -6.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8151 -6.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8143 -7.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5263 -8.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2414 -7.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2366 -6.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5263 -8.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8530 -9.4492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0934 -10.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6717 -10.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0782 -11.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9108 -11.6855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3288 -10.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9227 -10.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1874 -9.4735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6636 -12.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8345 -12.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0782 -13.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2491 -13.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6636 -13.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5035 -4.6469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 57 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 13 12 1 0 0 0 0\n 12 34 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 19 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 20 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 2 0 0 0 0\n 28 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 27 22 2 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 24 29 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 35 57 1 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 42 37 2 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 43 40 1 0 0 0 0\n 41 42 1 0 0 0 0\n 43 44 2 0 0 0 0\n 51 43 1 0 0 0 0\n 45 44 1 0 0 0 0\n 45 46 1 0 0 0 0\n 50 45 2 0 0 0 0\n 46 47 2 0 0 0 0\n 47 48 1 0 0 0 0\n 47 52 1 0 0 0 0\n 48 49 2 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 52 53 1 0 0 0 0\n 52 54 1 0 0 0 0\n 52 55 1 0 0 0 0\n 55 56 1 0 0 0 0\nM END",
"smiles": "CCCCC(CC)CNc1nc(Nc2ccc(cc2)-c3nc4cc(ccc4o3)C(C)(C)CC)nc(Nc5ccc(cc5)-c6nc7cc(ccc7o6)C(C)(C)CC)n1",
"formula": "C47H56N8O2",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "RACEMIC",
"count_amount": {
"type": "MOL RATIO",
"average": 1,
"units": "MOL RATIO",
"uuid": "4bbda8ae-c34b-4952-8462-a99aa939c136"
},
"defined_stereo": 0,
"ez_centers": 0,
"molecular_weight": "765.0017",
"optical_activity": "( + / - )",
"stereo_centers": 1
}
],
"definition_level": "COMPLETE",
"uuid": "d5cc5fb3-d212-48b2-87b1-0e243147bc75",
"version": "4",
"structure": {
"id": "53cc8f5f-d82d-427e-9e2a-6a434d632d70",
"molfile": "\n Marvin 01132104222D \n\n 57 63 0 0 0 0 999 V2000\n 3.2325 -11.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2478 -10.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8260 -10.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0771 -10.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0651 -11.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4831 -10.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6807 -8.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0073 -9.2320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3418 -9.2563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8180 -12.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2325 -12.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9889 -12.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4034 -12.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8180 -13.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6807 -7.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9694 -6.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9687 -7.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6816 -6.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3957 -7.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3910 -6.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6816 -5.4777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2893 -5.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9593 -4.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3531 -4.5352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5035 -4.6469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8358 -5.5895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4415 -5.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8151 -6.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8143 -7.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8345 -12.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6636 -13.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2491 -13.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0782 -13.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6636 -12.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8530 -9.4492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0934 -10.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6717 -10.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0782 -11.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9108 -11.6855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3288 -10.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9227 -10.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1874 -9.4735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5263 -8.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5263 -8.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2414 -7.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2366 -6.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5273 -6.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5273 -5.6949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9593 -3.5932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3825 -3.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3825 -2.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8057 -2.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8057 -1.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9593 -2.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9593 -1.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5360 -1.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5360 -0.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 2 3 1 0 0 0 0\n 1 5 1 0 0 0 0\n 4 2 2 0 0 0 0\n 3 1 2 0 0 0 0\n 9 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 2 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 1 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 7 15 1 0 0 0 0\n 20 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 2 0 0 0 0\n 17 15 2 0 0 0 0\n 15 19 1 0 0 0 0\n 18 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 27 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 23 2 0 0 0 0\n 24 22 2 0 0 0 0\n 22 26 1 0 0 0 0\n 47 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 44 2 0 0 0 0\n 34 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 34 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 38 34 1 0 0 0 0\n 43 35 2 0 0 0 0\n 36 35 1 0 0 0 0\n 41 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 2 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 27 48 1 0 0 0 0\n 23 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 1 0 0 0 0\n 51 54 1 0 0 0 0\n 54 55 1 0 0 0 0\n 55 56 1 0 0 0 0\n 56 57 1 0 0 0 0\nM END",
"smiles": "CCCCC(CC)CNc1nc(Nc2ccc(cc2)-c3nc4cc(ccc4o3)C(C)(C)CC)nc(Nc5ccc(cc5)-c6nc7cc(ccc7o6)C(C)(C)CC)n1",
"formula": "C47H56N8O2",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "RACEMIC",
"defined_stereo": 0,
"ez_centers": 0,
"molecular_weight": "765.0017",
"optical_activity": "( + / - )",
"references": [
"bd0386ed-e239-4157-aa1c-390548065d59",
"1a68b8de-ec2d-4858-a55b-b06a4a40d927"
],
"stereo_centers": 1
},
"unii": "BU9H717REF"
}
]
}
Work with this as data
Every example here is available over the APIs.io API and to AI agents over MCP.
MCP server
One button, every client — Claude, Cursor, VS Code and the rest.
https://apis.io/mcp
Tools for examples
4 MCP tools reach this
find_examplesBrowse and filter every example in the catalog.apis_io_searchSTART HERE — APIs, providers and tags for one query, each with its total.resolveTurn a domain, URL or GitHub org into the provider it belongs to.find_cohortsEvery scored population of providers in the catalog.
Call it yourself
curl for this page
This example
curl "https://apis.io/api/v1/examples/substance-data"
All examples
curl "https://apis.io/api/v1/examples?limit=25"
Discovery needs no key. Ratings and market analysis are Pro.
Get an API key
Free tier, no form to fill in. Signing in shares your email address with us — we store it to create your key and to recognise you if you sign in with another provider. See our Privacy Policy and Terms.
A second provider on the same verified email joins the account you already have.